About 1H-pyrimidine-4,6-dicarbonitrile
1H-pyrimidine-4,6-dicarbonitrile (PubChem CID 176525719) has the molecular formula C6H2N4
and a molecular weight of 130.11 g/mol. Its IUPAC name is 1H-pyrimidine-4,6-dicarbonitrile.
Molecular Properties
| Compound Name | 1H-pyrimidine-4,6-dicarbonitrile |
| PubChem CID | 176525719 |
| Molecular Formula | C6H2N4 |
| Molecular Weight | 130.11 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 1H-pyrimidine-4,6-dicarbonitrile |
| SMILES | N#CC1=C=C(C#N)NC=N1 |
| InChI | InChI=1S/C6H2N4/c7-2-5-1-6(3-8)10-4-9-5/h4H,(H,9,10) |
| InChIKey | AICWVVXRKLGWJN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.11 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-pyrimidine-4,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrimidine-4,6-dicarbonitrile?
The IUPAC name of 1H-pyrimidine-4,6-dicarbonitrile (CID 176525719) is 1H-pyrimidine-4,6-dicarbonitrile.
What is the SMILES notation for 1H-pyrimidine-4,6-dicarbonitrile?
The canonical SMILES for 1H-pyrimidine-4,6-dicarbonitrile is N#CC1=C=C(C#N)NC=N1.
What is the InChIKey of 1H-pyrimidine-4,6-dicarbonitrile?
The InChIKey is AICWVVXRKLGWJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N4/c7-2-5-1-6(3-8)10-4-9-5/h4H,(H,9,10).
What are the key properties of 1H-pyrimidine-4,6-dicarbonitrile?
1H-pyrimidine-4,6-dicarbonitrile has a molecular weight of 130.11 g/mol, XLogP of 0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrimidine-4,6-dicarbonitrile is sourced from PubChem (CID 176525719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).