C24H48N6 — CID 176525751
1-(4-carbamimidamidobutyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]guanidine (PubChem CID 176525751) has the molecular formula C24H48N6 and a molecular weight of 420.69 g/mol. Its IUPAC name is 1-(4-carbamimidamidobutyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]guanidine.
| Compound Name | 1-(4-carbamimidamidobutyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]guanidine |
|---|---|
| PubChem CID | 176525751 |
| Molecular Formula | C24H48N6 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.39 |
| IUPAC Name | 1-(4-carbamimidamidobutyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]guanidine |
| SMILES | [H]/N=C(\N)NCCCCN/C(N)=N/CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C24H48N6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-29-24(27)30-22-19-18-20-28-23(25)26/h6-7,9-10H,2-5,8,11-22H2,1H3,(H4,25,26,28)(H3,27,29,30)/b7-6-,10-9- |
| InChIKey | JRQHWUFHPJLUFF-HZJYTTRNSA-N |
| XLogP | 4.97 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|