H4N15P — CID 176526020
[(Z)-[(aminodiazenyl)diazenyl]-[(E)-(iminohydrazinylidene)hydrazinylidene]phosphaniumyl]-(diazenyldiazenyl)azanide (PubChem CID 176526020) has the molecular formula H4N15P and a molecular weight of 245.11 g/mol. Its IUPAC name is [(Z)-[(aminodiazenyl)diazenyl]-[(E)-(iminohydrazinylidene)hydrazinylidene]phosphaniumyl]-(diazenyldiazenyl)azanide.
| Compound Name | [(Z)-[(aminodiazenyl)diazenyl]-[(E)-(iminohydrazinylidene)hydrazinylidene]phosphaniumyl]-(diazenyldiazenyl)azanide |
|---|---|
| PubChem CID | 176526020 |
| Molecular Formula | H4N15P |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | [(Z)-[(aminodiazenyl)diazenyl]-[(E)-(iminohydrazinylidene)hydrazinylidene]phosphaniumyl]-(diazenyldiazenyl)azanide |
| SMILES | [H]/N=N/N=N[N-]/[P+](N=NN=NN)=N/N=N/N=N/[H] |
| InChI | InChI=1S/H4N15P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h(H4,1,2,3,7,8,9,13,14,15) |
| InChIKey | CKMVTKURJSYORE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 223.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|