C25H18F7NO2 — CID 176526259
methyl (E)-2-benzyl-4-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]but-3-enoate (PubChem CID 176526259) has the molecular formula C25H18F7NO2 and a molecular weight of 497.41 g/mol. Its IUPAC name is methyl (E)-2-benzyl-4-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]but-3-enoate.
| Compound Name | methyl (E)-2-benzyl-4-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]but-3-enoate |
|---|---|
| PubChem CID | 176526259 |
| Molecular Formula | C25H18F7NO2 |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | methyl (E)-2-benzyl-4-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]but-3-enoate |
| SMILES | COC(=O)C(/C=C/c1ccccc1)(Cc1ccccc1)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C25H18F7NO2/c1-35-23(34)24(14-16-10-6-3-7-11-16,13-12-15-8-4-2-5-9-15)33-22-20(28)18(26)17(25(30,31)32)19(27)21(22)29/h2-13,33H,14H2,1H3/b13-12+ |
| InChIKey | BXJNWFIASCGHRF-OUKQBFOZSA-N |
| XLogP | 6.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|