C24H19F4NO2 — CID 176526265
ethyl (E)-2,4-diphenyl-2-(2,3,5,6-tetrafluoroanilino)but-3-enoate (PubChem CID 176526265) has the molecular formula C24H19F4NO2 and a molecular weight of 429.41 g/mol. Its IUPAC name is ethyl (E)-2,4-diphenyl-2-(2,3,5,6-tetrafluoroanilino)but-3-enoate.
| Compound Name | ethyl (E)-2,4-diphenyl-2-(2,3,5,6-tetrafluoroanilino)but-3-enoate |
|---|---|
| PubChem CID | 176526265 |
| Molecular Formula | C24H19F4NO2 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | ethyl (E)-2,4-diphenyl-2-(2,3,5,6-tetrafluoroanilino)but-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccccc1)(Nc1c(F)c(F)cc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C24H19F4NO2/c1-2-31-23(30)24(17-11-7-4-8-12-17,14-13-16-9-5-3-6-10-16)29-22-20(27)18(25)15-19(26)21(22)28/h3-15,29H,2H2,1H3/b14-13+ |
| InChIKey | LMTCHVMTEJHRJO-BUHFOSPRSA-N |
| XLogP | 5.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|