C24H20F3NO2 — CID 176526266
ethyl (E)-2,4-diphenyl-2-(2,4,6-trifluoroanilino)but-3-enoate (PubChem CID 176526266) has the molecular formula C24H20F3NO2 and a molecular weight of 411.42 g/mol. Its IUPAC name is ethyl (E)-2,4-diphenyl-2-(2,4,6-trifluoroanilino)but-3-enoate.
| Compound Name | ethyl (E)-2,4-diphenyl-2-(2,4,6-trifluoroanilino)but-3-enoate |
|---|---|
| PubChem CID | 176526266 |
| Molecular Formula | C24H20F3NO2 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | ethyl (E)-2,4-diphenyl-2-(2,4,6-trifluoroanilino)but-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccccc1)(Nc1c(F)cc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C24H20F3NO2/c1-2-30-23(29)24(18-11-7-4-8-12-18,14-13-17-9-5-3-6-10-17)28-22-20(26)15-19(25)16-21(22)27/h3-16,28H,2H2,1H3/b14-13+ |
| InChIKey | NLSKGVXVMABMNT-BUHFOSPRSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |