About ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate
ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate (PubChem CID 176526267) has the molecular formula C24H20BrF2NO2
and a molecular weight of 472.33 g/mol. Its IUPAC name is ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate |
| PubChem CID | 176526267 |
| Molecular Formula | C24H20BrF2NO2 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccccc1)(Nc1c(F)cc(Br)cc1F)c1ccccc1 |
| InChI | InChI=1S/C24H20BrF2NO2/c1-2-30-23(29)24(18-11-7-4-8-12-18,14-13-17-9-5-3-6-10-17)28-22-20(26)15-19(25)16-21(22)27/h3-16,28H,2H2,1H3/b14-13+ |
| InChIKey | OIARTJDXLBXKCH-BUHFOSPRSA-N |
| XLogP | 6.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate?
The IUPAC name of ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate (CID 176526267) is ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate.
What is the SMILES notation for ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate?
The canonical SMILES for ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate is CCOC(=O)C(/C=C/c1ccccc1)(Nc1c(F)cc(Br)cc1F)c1ccccc1.
What is the InChIKey of ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate?
The InChIKey is OIARTJDXLBXKCH-BUHFOSPRSA-N. The full InChI is InChI=1S/C24H20BrF2NO2/c1-2-30-23(29)24(18-11-7-4-8-12-18,14-13-17-9-5-3-6-10-17)28-22-20(26)15-19(25)16-21(22)27/h3-16,28H,2H2,1H3/b14-13+.
What are the key properties of ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate?
ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate has a molecular weight of 472.33 g/mol, XLogP of 6.31, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-(4-bromo-2,6-difluoroanilino)-2,4-diphenylbut-3-enoate is sourced from PubChem (CID 176526267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).