C24H21F2NO2 — CID 176526269
ethyl (E)-2-(2,6-difluoroanilino)-2,4-diphenylbut-3-enoate (PubChem CID 176526269) has the molecular formula C24H21F2NO2 and a molecular weight of 393.43 g/mol. Its IUPAC name is ethyl (E)-2-(2,6-difluoroanilino)-2,4-diphenylbut-3-enoate.
| Compound Name | ethyl (E)-2-(2,6-difluoroanilino)-2,4-diphenylbut-3-enoate |
|---|---|
| PubChem CID | 176526269 |
| Molecular Formula | C24H21F2NO2 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl (E)-2-(2,6-difluoroanilino)-2,4-diphenylbut-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccccc1)(Nc1c(F)cccc1F)c1ccccc1 |
| InChI | InChI=1S/C24H21F2NO2/c1-2-29-23(28)24(19-12-7-4-8-13-19,17-16-18-10-5-3-6-11-18)27-22-20(25)14-9-15-21(22)26/h3-17,27H,2H2,1H3/b17-16+ |
| InChIKey | UGDYAQIHMJGSIH-WUKNDPDISA-N |
| XLogP | 5.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |