C24H19BrF3NO2 — CID 176526270
ethyl (E)-2-(2-bromo-3,4,6-trifluoroanilino)-2,4-diphenylbut-3-enoate (PubChem CID 176526270) has the molecular formula C24H19BrF3NO2 and a molecular weight of 490.32 g/mol. Its IUPAC name is ethyl (E)-2-(2-bromo-3,4,6-trifluoroanilino)-2,4-diphenylbut-3-enoate.
| Compound Name | ethyl (E)-2-(2-bromo-3,4,6-trifluoroanilino)-2,4-diphenylbut-3-enoate |
|---|---|
| PubChem CID | 176526270 |
| Molecular Formula | C24H19BrF3NO2 |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | ethyl (E)-2-(2-bromo-3,4,6-trifluoroanilino)-2,4-diphenylbut-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccccc1)(Nc1c(F)cc(F)c(F)c1Br)c1ccccc1 |
| InChI | InChI=1S/C24H19BrF3NO2/c1-2-31-23(30)24(17-11-7-4-8-12-17,14-13-16-9-5-3-6-10-16)29-22-19(27)15-18(26)21(28)20(22)25/h3-15,29H,2H2,1H3/b14-13+ |
| InChIKey | DITYUVJIZFBLNU-BUHFOSPRSA-N |
| XLogP | 6.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|