C21H17Cl2N3O3S2 — CID 176526481
3-[1-[(2,4-dichlorophenyl)methyl]-5,6-dihydro-4H-indazol-7-ylidene]-N-thiophen-2-ylsulfonylprop-2-enamide (PubChem CID 176526481) has the molecular formula C21H17Cl2N3O3S2 and a molecular weight of 494.43 g/mol. Its IUPAC name is 3-[1-[(2,4-dichlorophenyl)methyl]-5,6-dihydro-4H-indazol-7-ylidene]-N-thiophen-2-ylsulfonylprop-2-enamide.
| Compound Name | 3-[1-[(2,4-dichlorophenyl)methyl]-5,6-dihydro-4H-indazol-7-ylidene]-N-thiophen-2-ylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 176526481 |
| Molecular Formula | C21H17Cl2N3O3S2 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | 3-[1-[(2,4-dichlorophenyl)methyl]-5,6-dihydro-4H-indazol-7-ylidene]-N-thiophen-2-ylsulfonylprop-2-enamide |
| SMILES | O=C(C=C=C1CCCc2cnn(Cc3ccc(Cl)cc3Cl)c21)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H17Cl2N3O3S2/c22-17-8-6-16(18(23)11-17)13-26-21-14(3-1-4-15(21)12-24-26)7-9-19(27)25-31(28,29)20-5-2-10-30-20/h2,5-6,8-12H,1,3-4,13H2,(H,25,27) |
| InChIKey | JZFIYBXLZISHKQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|