About N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide
N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide (PubChem CID 176526586) has the molecular formula C7H16N6O
and a molecular weight of 200.25 g/mol. Its IUPAC name is N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide |
| PubChem CID | 176526586 |
| Molecular Formula | C7H16N6O |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide |
| SMILES | C/N=C(\NC(N)=NN)N1CCOCC1 |
| InChI | InChI=1S/C7H16N6O/c1-10-7(11-6(8)12-9)13-2-4-14-5-3-13/h2-5,9H2,1H3,(H3,8,10,11,12) |
| InChIKey | RQSGDBXEEHDPOB-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide?
The IUPAC name of N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide (CID 176526586) is N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide.
What is the SMILES notation for N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide?
The canonical SMILES for N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide is C/N=C(\NC(N)=NN)N1CCOCC1.
What is the InChIKey of N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide?
The InChIKey is RQSGDBXEEHDPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N6O/c1-10-7(11-6(8)12-9)13-2-4-14-5-3-13/h2-5,9H2,1H3,(H3,8,10,11,12).
What are the key properties of N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide?
N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide has a molecular weight of 200.25 g/mol, XLogP of -1.92, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamohydrazonoyl-N'-methylmorpholine-4-carboximidamide is sourced from PubChem (CID 176526586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).