About N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide
N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide (PubChem CID 176526826) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide.
Molecular Properties
| Compound Name | N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide |
| PubChem CID | 176526826 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide |
| SMILES | [H]/N=C/N=C/C1=CNNC1CC |
| InChI | InChI=1S/C7H12N4/c1-2-7-6(3-9-5-8)4-10-11-7/h3-5,7-8,10-11H,2H2,1H3/b8-5+,9-3+ |
| InChIKey | XWCHBJDDPKVQRQ-MXJIWBSISA-N |
| XLogP | 0.43 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide?
The IUPAC name of N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide (CID 176526826) is N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide.
What is the SMILES notation for N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide?
The canonical SMILES for N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide is [H]/N=C/N=C/C1=CNNC1CC.
What is the InChIKey of N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide?
The InChIKey is XWCHBJDDPKVQRQ-MXJIWBSISA-N. The full InChI is InChI=1S/C7H12N4/c1-2-7-6(3-9-5-8)4-10-11-7/h3-5,7-8,10-11H,2H2,1H3/b8-5+,9-3+.
What are the key properties of N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide?
N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide has a molecular weight of 152.20 g/mol, XLogP of 0.43, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-ethyl-2,3-dihydro-1H-pyrazol-4-yl)methylidene]methanimidamide is sourced from PubChem (CID 176526826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).