About N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine
N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine (PubChem CID 176527107) has the molecular formula C10H15N5
and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine.
Molecular Properties
| Compound Name | N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine |
| PubChem CID | 176527107 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine |
| SMILES | CC(C)=CCNC1=C2NC=NC2NC=N1 |
| InChI | InChI=1S/C10H15N5/c1-7(2)3-4-11-9-8-10(13-5-12-8)15-6-14-9/h3,5-6,10-11H,4H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | YPYPHTQWMJNHFN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine?
The IUPAC name of N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine (CID 176527107) is N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine.
What is the SMILES notation for N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine?
The canonical SMILES for N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine is CC(C)=CCNC1=C2NC=NC2NC=N1.
What is the InChIKey of N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine?
The InChIKey is YPYPHTQWMJNHFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5/c1-7(2)3-4-11-9-8-10(13-5-12-8)15-6-14-9/h3,5-6,10-11H,4H2,1-2H3,(H,12,13)(H,14,15).
What are the key properties of N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine?
N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine has a molecular weight of 205.26 g/mol, XLogP of 0.30, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylbut-2-enyl)-4,7-dihydro-3H-purin-6-amine is sourced from PubChem (CID 176527107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).