C12H15N5 — CID 176527108
N-[(2E)-2-ethenylpenta-2,4-dienyl]-4,7-dihydro-3H-purin-6-amine (PubChem CID 176527108) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is N-[(2E)-2-ethenylpenta-2,4-dienyl]-4,7-dihydro-3H-purin-6-amine.
| Compound Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]-4,7-dihydro-3H-purin-6-amine |
|---|---|
| PubChem CID | 176527108 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]-4,7-dihydro-3H-purin-6-amine |
| SMILES | C=C/C=C(\C=C)CNC1=C2NC=NC2NC=N1 |
| InChI | InChI=1S/C12H15N5/c1-3-5-9(4-2)6-13-11-10-12(15-7-14-10)17-8-16-11/h3-5,7-8,12-13H,1-2,6H2,(H,14,15)(H,16,17)/b9-5+ |
| InChIKey | OCXQNAMKCYDRPQ-WEVVVXLNSA-N |
| XLogP | 0.63 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|