C45H92N14O — CID 176527294
1,3-bis(8-carbamimidamidooctyl)-1,3-bis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea (PubChem CID 176527294) has the molecular formula C45H92N14O and a molecular weight of 845.33 g/mol. Its IUPAC name is 1,3-bis(8-carbamimidamidooctyl)-1,3-bis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea.
| Compound Name | 1,3-bis(8-carbamimidamidooctyl)-1,3-bis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea |
|---|---|
| PubChem CID | 176527294 |
| Molecular Formula | C45H92N14O |
| Molecular Weight | 845.33 g/mol |
| Exact Mass | 844.76 |
| IUPAC Name | 1,3-bis(8-carbamimidamidooctyl)-1,3-bis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea |
| SMILES | [H]/N=C(\N)NCCCCCCCCN(CCCCCCCCN/C(N)=N/CC1CC1)C(=O)N(CCCCCCCCN/C(N)=N/[H])CCCCCCCCN/C(N)=N/CC1CC1 |
| InChI | InChI=1S/C45H92N14O/c46-41(47)52-29-17-9-1-5-13-21-33-58(35-23-15-7-3-11-19-31-54-43(50)56-37-39-25-26-39)45(60)59(34-22-14-6-2-10-18-30-53-42(48)49)36-24-16-8-4-12-20-32-55-44(51)57-38-40-27-28-40/h39-40H,1-38H2,(H4,46,47,52)(H4,48,49,53)(H3,50,54,56)(H3,51,55,57) |
| InChIKey | VMIMWAHXYZOQRS-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 248.17 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.33 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|