About 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride
3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride (PubChem CID 176527354) has the molecular formula C7H14ClN5
and a molecular weight of 203.68 g/mol. Its IUPAC name is 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride.
Molecular Properties
| Compound Name | 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride |
| PubChem CID | 176527354 |
| Molecular Formula | C7H14ClN5 |
| Molecular Weight | 203.68 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N/C(=N/C#CC)N(C)C |
| InChI | InChI=1S/C7H13N5.ClH/c1-4-5-10-7(12(2)3)11-6(8)9;/h1-3H3,(H4,8,9,10,11);1H |
| InChIKey | OKBDKPYDXZNSJU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.68 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride?
The IUPAC name of 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride (CID 176527354) is 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride.
What is the SMILES notation for 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride?
The canonical SMILES for 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride is Cl.[H]/N=C(\N)N/C(=N/C#CC)N(C)C.
What is the InChIKey of 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride?
The InChIKey is OKBDKPYDXZNSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5.ClH/c1-4-5-10-7(12(2)3)11-6(8)9;/h1-3H3,(H4,8,9,10,11);1H.
What are the key properties of 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride?
3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride has a molecular weight of 203.68 g/mol, XLogP of -0.21, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carbamimidoyl-1,1-dimethyl-2-prop-1-ynylguanidine;hydrochloride is sourced from PubChem (CID 176527354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).