About (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine
(3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine (PubChem CID 176527524) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine |
| PubChem CID | 176527524 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine |
| SMILES | C1=CC2NC=N[C@@H]2C=N1 |
| InChI | InChI=1S/C6H7N3/c1-2-7-3-6-5(1)8-4-9-6/h1-6H,(H,8,9)/t5?,6-/m1/s1 |
| InChIKey | QYSHVORUQQRXCH-PRJDIBJQSA-N |
| XLogP | -0.05 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine?
The IUPAC name of (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine (CID 176527524) is (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine.
What is the SMILES notation for (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine?
The canonical SMILES for (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine is C1=CC2NC=N[C@@H]2C=N1.
What is the InChIKey of (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine?
The InChIKey is QYSHVORUQQRXCH-PRJDIBJQSA-N. The full InChI is InChI=1S/C6H7N3/c1-2-7-3-6-5(1)8-4-9-6/h1-6H,(H,8,9)/t5?,6-/m1/s1.
What are the key properties of (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine?
(3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine has a molecular weight of 121.14 g/mol, XLogP of -0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS)-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 176527524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).