About 9-methyl-4,5-dihydro-1H-purin-6-imine
9-methyl-4,5-dihydro-1H-purin-6-imine (PubChem CID 176527559) has the molecular formula C6H9N5
and a molecular weight of 151.17 g/mol. Its IUPAC name is 9-methyl-4,5-dihydro-1H-purin-6-imine.
Molecular Properties
| Compound Name | 9-methyl-4,5-dihydro-1H-purin-6-imine |
| PubChem CID | 176527559 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | 9-methyl-4,5-dihydro-1H-purin-6-imine |
| SMILES | [H]/N=C1\NC=NC2C1N=CN2C |
| InChI | InChI=1S/C6H9N5/c1-11-3-10-4-5(7)8-2-9-6(4)11/h2-4,6H,1H3,(H2,7,8,9) |
| InChIKey | JTHAQTIBTQDFQS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-4,5-dihydro-1H-purin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-4,5-dihydro-1H-purin-6-imine?
The IUPAC name of 9-methyl-4,5-dihydro-1H-purin-6-imine (CID 176527559) is 9-methyl-4,5-dihydro-1H-purin-6-imine.
What is the SMILES notation for 9-methyl-4,5-dihydro-1H-purin-6-imine?
The canonical SMILES for 9-methyl-4,5-dihydro-1H-purin-6-imine is [H]/N=C1\NC=NC2C1N=CN2C.
What is the InChIKey of 9-methyl-4,5-dihydro-1H-purin-6-imine?
The InChIKey is JTHAQTIBTQDFQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5/c1-11-3-10-4-5(7)8-2-9-6(4)11/h2-4,6H,1H3,(H2,7,8,9).
What are the key properties of 9-methyl-4,5-dihydro-1H-purin-6-imine?
9-methyl-4,5-dihydro-1H-purin-6-imine has a molecular weight of 151.17 g/mol, XLogP of -0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-4,5-dihydro-1H-purin-6-imine is sourced from PubChem (CID 176527559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).