About (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine
(2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine (PubChem CID 176528561) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine.
Molecular Properties
| Compound Name | (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine |
| PubChem CID | 176528561 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine |
| SMILES | [H]/N=C1\N=CN/C(=C(/C=C)C(C)C)N1C |
| InChI | InChI=1S/C10H16N4/c1-5-8(7(2)3)9-12-6-13-10(11)14(9)4/h5-7H,1H2,2-4H3,(H2,11,12,13)/b9-8+ |
| InChIKey | SYSFDLWJZZVYGE-CMDGGOBGSA-N |
| XLogP | 1.54 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine?
The IUPAC name of (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine (CID 176528561) is (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine.
What is the SMILES notation for (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine?
The canonical SMILES for (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine is [H]/N=C1\N=CN/C(=C(/C=C)C(C)C)N1C.
What is the InChIKey of (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine?
The InChIKey is SYSFDLWJZZVYGE-CMDGGOBGSA-N. The full InChI is InChI=1S/C10H16N4/c1-5-8(7(2)3)9-12-6-13-10(11)14(9)4/h5-7H,1H2,2-4H3,(H2,11,12,13)/b9-8+.
What are the key properties of (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine?
(2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine has a molecular weight of 192.27 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-methyl-2-(4-methylpent-1-en-3-ylidene)-1H-1,3,5-triazin-4-imine is sourced from PubChem (CID 176528561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).