About 2-carbamimidoyl-1,1-dipentylguanidine
2-carbamimidoyl-1,1-dipentylguanidine (PubChem CID 176528677) has the molecular formula C12H27N5
and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dipentylguanidine.
Molecular Properties
| Compound Name | 2-carbamimidoyl-1,1-dipentylguanidine |
| PubChem CID | 176528677 |
| Molecular Formula | C12H27N5 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.23 |
| IUPAC Name | 2-carbamimidoyl-1,1-dipentylguanidine |
| SMILES | [H]/N=C(N)/N=C(\N)N(CCCCC)CCCCC |
| InChI | InChI=1S/C12H27N5/c1-3-5-7-9-17(10-8-6-4-2)12(15)16-11(13)14/h3-10H2,1-2H3,(H5,13,14,15,16) |
| InChIKey | ASLUEXWHMHPYQQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamimidoyl-1,1-dipentylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamimidoyl-1,1-dipentylguanidine?
The IUPAC name of 2-carbamimidoyl-1,1-dipentylguanidine (CID 176528677) is 2-carbamimidoyl-1,1-dipentylguanidine.
What is the SMILES notation for 2-carbamimidoyl-1,1-dipentylguanidine?
The canonical SMILES for 2-carbamimidoyl-1,1-dipentylguanidine is [H]/N=C(N)/N=C(\N)N(CCCCC)CCCCC.
What is the InChIKey of 2-carbamimidoyl-1,1-dipentylguanidine?
The InChIKey is ASLUEXWHMHPYQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N5/c1-3-5-7-9-17(10-8-6-4-2)12(15)16-11(13)14/h3-10H2,1-2H3,(H5,13,14,15,16).
What are the key properties of 2-carbamimidoyl-1,1-dipentylguanidine?
2-carbamimidoyl-1,1-dipentylguanidine has a molecular weight of 241.38 g/mol, XLogP of 1.88, 8 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamimidoyl-1,1-dipentylguanidine is sourced from PubChem (CID 176528677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).