C15H21NO — CID 176528728
3-[(1R,7S)-6-amino-9-ethyl-3-bicyclo[5.2.0]nona-4,5-dienyl]but-3-en-2-one (PubChem CID 176528728) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[(1R,7S)-6-amino-9-ethyl-3-bicyclo[5.2.0]nona-4,5-dienyl]but-3-en-2-one.
| Compound Name | 3-[(1R,7S)-6-amino-9-ethyl-3-bicyclo[5.2.0]nona-4,5-dienyl]but-3-en-2-one |
|---|---|
| PubChem CID | 176528728 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 3-[(1R,7S)-6-amino-9-ethyl-3-bicyclo[5.2.0]nona-4,5-dienyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)C1C=C=C(N)[C@H]2CC(CC)[C@H]2C1 |
| InChI | InChI=1S/C15H21NO/c1-4-11-7-14-13(11)8-12(5-6-15(14)16)9(2)10(3)17/h5,11-14H,2,4,7-8,16H2,1,3H3/t11?,12?,13-,14+/m1/s1 |
| InChIKey | WTHCTGQUPQTZJW-PQAZSJQKSA-N |
| XLogP | 2.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|