About (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one
(3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one (PubChem CID 176528836) has the molecular formula C4H4O3S
and a molecular weight of 132.14 g/mol. Its IUPAC name is (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one.
Molecular Properties
| Compound Name | (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one |
| PubChem CID | 176528836 |
| Molecular Formula | C4H4O3S |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 131.99 |
| IUPAC Name | (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one |
| SMILES | O=C1CC[C@@]2(OS2)O1 |
| InChI | InChI=1S/C4H4O3S/c5-3-1-2-4(6-3)7-8-4/h1-2H2/t4-/m0/s1 |
| InChIKey | DTYDSISHYBTXEY-BYPYZUCNSA-N |
| XLogP | 0.66 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one?
The IUPAC name of (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one (CID 176528836) is (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one.
What is the SMILES notation for (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one?
The canonical SMILES for (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one is O=C1CC[C@@]2(OS2)O1.
What is the InChIKey of (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one?
The InChIKey is DTYDSISHYBTXEY-BYPYZUCNSA-N. The full InChI is InChI=1S/C4H4O3S/c5-3-1-2-4(6-3)7-8-4/h1-2H2/t4-/m0/s1.
What are the key properties of (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one?
(3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one has a molecular weight of 132.14 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,7-dioxa-2-thiaspiro[2.4]heptan-6-one is sourced from PubChem (CID 176528836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).