About 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one
2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one (PubChem CID 176529167) has the molecular formula C29H19N5O
and a molecular weight of 453.51 g/mol. Its IUPAC name is 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one.
Molecular Properties
| Compound Name | 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one |
| PubChem CID | 176529167 |
| Molecular Formula | C29H19N5O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one |
| SMILES | C=CC(=C=O)n1ccc2ccc(Nc3ncnc4ccc(-c5cnc6ccccc6c5)cc34)cc21 |
| InChI | InChI=1S/C29H19N5O/c1-2-24(17-35)34-12-11-19-7-9-23(15-28(19)34)33-29-25-14-20(8-10-27(25)31-18-32-29)22-13-21-5-3-4-6-26(21)30-16-22/h2-16,18H,1H2,(H,31,32,33) |
| InChIKey | RNVIGMJXSPAYOT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one?
The IUPAC name of 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one (CID 176529167) is 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one.
What is the SMILES notation for 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one?
The canonical SMILES for 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one is C=CC(=C=O)n1ccc2ccc(Nc3ncnc4ccc(-c5cnc6ccccc6c5)cc34)cc21.
What is the InChIKey of 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one?
The InChIKey is RNVIGMJXSPAYOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H19N5O/c1-2-24(17-35)34-12-11-19-7-9-23(15-28(19)34)33-29-25-14-20(8-10-27(25)31-18-32-29)22-13-21-5-3-4-6-26(21)30-16-22/h2-16,18H,1H2,(H,31,32,33).
What are the key properties of 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one?
2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one has a molecular weight of 453.51 g/mol, XLogP of 6.40, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]indol-1-yl]buta-1,3-dien-1-one is sourced from PubChem (CID 176529167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).