About 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine
1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine (PubChem CID 176529298) has the molecular formula C10H17N5
and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine.
Molecular Properties
| Compound Name | 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine |
| PubChem CID | 176529298 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/C1(C)C=CC=CC1C |
| InChI | InChI=1S/C10H17N5/c1-7-5-3-4-6-10(7,2)15-9(13)14-8(11)12/h3-7H,1-2H3,(H6,11,12,13,14,15) |
| InChIKey | LGHAGNVYXGWDBM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine?
The IUPAC name of 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine (CID 176529298) is 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine.
What is the SMILES notation for 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine?
The canonical SMILES for 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine is [H]/N=C(\N)N/C(N)=N/C1(C)C=CC=CC1C.
What is the InChIKey of 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine?
The InChIKey is LGHAGNVYXGWDBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5/c1-7-5-3-4-6-10(7,2)15-9(13)14-8(11)12/h3-7H,1-2H3,(H6,11,12,13,14,15).
What are the key properties of 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine?
1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine has a molecular weight of 207.28 g/mol, XLogP of 0.30, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoyl-2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)guanidine is sourced from PubChem (CID 176529298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).