C17H39N7+2 — CID 176529549
(1E)-1-[amino-[4-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)butylamino]methylidene]-2-(2-methylpropyl)guanidine (PubChem CID 176529549) has the molecular formula C17H39N7+2 and a molecular weight of 341.55 g/mol. Its IUPAC name is (1E)-1-[amino-[4-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)butylamino]methylidene]-2-(2-methylpropyl)guanidine.
| Compound Name | (1E)-1-[amino-[4-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)butylamino]methylidene]-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 176529549 |
| Molecular Formula | C17H39N7+2 |
| Molecular Weight | 341.55 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | (1E)-1-[amino-[4-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)butylamino]methylidene]-2-(2-methylpropyl)guanidine |
| SMILES | CC(C)C/N=C(N)/N=C(\N)NCCCC[N+]1(C)CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C17H39N7/c1-15(2)14-21-17(19)22-16(18)20-8-6-7-9-24(5)12-10-23(3,4)11-13-24/h15H,6-14H2,1-5H3,(H5,18,19,20,21,22)/q+2 |
| InChIKey | ACUPKMXJAUOKHV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.55 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|