C15H22FN5 — CID 176530661
6-fluoro-2-N,4-N,4-N,6-tetrakis(prop-2-enyl)-1H-1,3,5-triazine-2,4-diamine (PubChem CID 176530661) has the molecular formula C15H22FN5 and a molecular weight of 291.37 g/mol. Its IUPAC name is 6-fluoro-2-N,4-N,4-N,6-tetrakis(prop-2-enyl)-1H-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-fluoro-2-N,4-N,4-N,6-tetrakis(prop-2-enyl)-1H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 176530661 |
| Molecular Formula | C15H22FN5 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 6-fluoro-2-N,4-N,4-N,6-tetrakis(prop-2-enyl)-1H-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNC1=NC(N(CC=C)CC=C)=NC(F)(CC=C)N1 |
| InChI | InChI=1S/C15H22FN5/c1-5-9-15(16)19-13(17-10-6-2)18-14(20-15)21(11-7-3)12-8-4/h5-8H,1-4,9-12H2,(H2,17,18,19,20) |
| InChIKey | ITBBADZTZVZYFX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|