C7H8N4 — CID 176530724
3-methyl-2H-pyrido[1,2-b][1,2,4,5]tetrazine (PubChem CID 176530724) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 3-methyl-2H-pyrido[1,2-b][1,2,4,5]tetrazine.
| Compound Name | 3-methyl-2H-pyrido[1,2-b][1,2,4,5]tetrazine |
|---|---|
| PubChem CID | 176530724 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 3-methyl-2H-pyrido[1,2-b][1,2,4,5]tetrazine |
| SMILES | CC1=NN2C=CC=CC2=NN1 |
| InChI | InChI=1S/C7H8N4/c1-6-8-9-7-4-2-3-5-11(7)10-6/h2-5H,1H3,(H,8,10) |
| InChIKey | MKECXGQDTIUPQE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |