C13H23F4N5 — CID 176531045
N-[N'-(3,3-difluorohexyl)carbamimidoyl]-4,4-difluoropiperidine-1-carboximidamide (PubChem CID 176531045) has the molecular formula C13H23F4N5 and a molecular weight of 325.35 g/mol. Its IUPAC name is N-[N'-(3,3-difluorohexyl)carbamimidoyl]-4,4-difluoropiperidine-1-carboximidamide.
| Compound Name | N-[N'-(3,3-difluorohexyl)carbamimidoyl]-4,4-difluoropiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 176531045 |
| Molecular Formula | C13H23F4N5 |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[N'-(3,3-difluorohexyl)carbamimidoyl]-4,4-difluoropiperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N/C(N)=N/CCC(F)(F)CCC)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H23F4N5/c1-2-3-12(14,15)4-7-20-10(18)21-11(19)22-8-5-13(16,17)6-9-22/h2-9H2,1H3,(H4,18,19,20,21) |
| InChIKey | KFEMZBXRLLYBRE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|