C24H38N4 — CID 176531143
(2Z,4E,6Z)-6-[1-[4-(1-aminoethyl)cyclohexyl]ethylideneamino]-3-methanimidoyl-4,7,8-trimethyldeca-2,4,6,8,9-pentaen-2-amine (PubChem CID 176531143) has the molecular formula C24H38N4 and a molecular weight of 382.60 g/mol. Its IUPAC name is (2Z,4E,6Z)-6-[1-[4-(1-aminoethyl)cyclohexyl]ethylideneamino]-3-methanimidoyl-4,7,8-trimethyldeca-2,4,6,8,9-pentaen-2-amine.
| Compound Name | (2Z,4E,6Z)-6-[1-[4-(1-aminoethyl)cyclohexyl]ethylideneamino]-3-methanimidoyl-4,7,8-trimethyldeca-2,4,6,8,9-pentaen-2-amine |
|---|---|
| PubChem CID | 176531143 |
| Molecular Formula | C24H38N4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (2Z,4E,6Z)-6-[1-[4-(1-aminoethyl)cyclohexyl]ethylideneamino]-3-methanimidoyl-4,7,8-trimethyldeca-2,4,6,8,9-pentaen-2-amine |
| SMILES | [H]/N=C/C(=C(/C)N)/C(C)=C/C(/N=C(\C)C1CCC(C(C)N)CC1)=C(\C)C(C)=C=C |
| InChI | InChI=1S/C24H38N4/c1-8-15(2)17(4)24(13-16(3)23(14-25)19(6)27)28-20(7)22-11-9-21(10-12-22)18(5)26/h13-14,18,21-22,25H,1,9-12,26-27H2,2-7H3/b16-13+,23-19+,24-17-,25-14+,28-20+ |
| InChIKey | ONESYAFONKHTQD-TYLKVDDRSA-N |
| XLogP | 5.43 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|