About 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine
1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine (PubChem CID 176531520) has the molecular formula C10H15N5
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine.
Molecular Properties
| Compound Name | 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine |
| PubChem CID | 176531520 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/C1(C=C)C=CC=CC1 |
| InChI | InChI=1S/C10H15N5/c1-2-10(6-4-3-5-7-10)15-9(13)14-8(11)12/h2-6H,1,7H2,(H6,11,12,13,14,15) |
| InChIKey | QPXGRUIPCZPDJS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine?
The IUPAC name of 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine (CID 176531520) is 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine.
What is the SMILES notation for 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine?
The canonical SMILES for 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine is [H]/N=C(\N)N/C(N)=N/C1(C=C)C=CC=CC1.
What is the InChIKey of 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine?
The InChIKey is QPXGRUIPCZPDJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5/c1-2-10(6-4-3-5-7-10)15-9(13)14-8(11)12/h2-6H,1,7H2,(H6,11,12,13,14,15).
What are the key properties of 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine?
1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine has a molecular weight of 205.26 g/mol, XLogP of 0.23, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoyl-2-(1-ethenylcyclohexa-2,4-dien-1-yl)guanidine is sourced from PubChem (CID 176531520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).