C28H55N7 — CID 176531616
2-N,2-N,4-N,4-N-tetrabutyl-6-N-(2,2-dimethyl-6-methylidenepiperidin-4-yl)-6-N-methyl-1,2-dihydro-1,3,5-triazine-2,4,6-triamine (PubChem CID 176531616) has the molecular formula C28H55N7 and a molecular weight of 489.80 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetrabutyl-6-N-(2,2-dimethyl-6-methylidenepiperidin-4-yl)-6-N-methyl-1,2-dihydro-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetrabutyl-6-N-(2,2-dimethyl-6-methylidenepiperidin-4-yl)-6-N-methyl-1,2-dihydro-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 176531616 |
| Molecular Formula | C28H55N7 |
| Molecular Weight | 489.80 g/mol |
| Exact Mass | 489.45 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetrabutyl-6-N-(2,2-dimethyl-6-methylidenepiperidin-4-yl)-6-N-methyl-1,2-dihydro-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=C1CC(N(C)C2=NC(N(CCCC)CCCC)=NC(N(CCCC)CCCC)N2)CC(C)(C)N1 |
| InChI | InChI=1S/C28H55N7/c1-9-13-17-34(18-14-10-2)26-29-25(33(8)24-21-23(5)32-28(6,7)22-24)30-27(31-26)35(19-15-11-3)20-16-12-4/h24,26,32H,5,9-22H2,1-4,6-8H3,(H,29,30,31) |
| InChIKey | BIIMHLGMJJDPSR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 58.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.80 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |