C28H27N5O4 — CID 176531766
N-[4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-[(3S)-oxolan-3-yl]oxyphenyl]buta-2,3-dienamide (PubChem CID 176531766) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is N-[4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-[(3S)-oxolan-3-yl]oxyphenyl]buta-2,3-dienamide.
| Compound Name | N-[4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-[(3S)-oxolan-3-yl]oxyphenyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176531766 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-[(3S)-oxolan-3-yl]oxyphenyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OC)cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C28H27N5O4/c1-4-7-27(34)30-23-14-22(25(35-3)15-26(23)37-18-11-13-36-17-18)32-28-29-12-10-21(31-28)20-16-33(2)24-9-6-5-8-19(20)24/h5-10,12,14-16,18H,1,11,13,17H2,2-3H3,(H,30,34)(H,29,31,32)/t18-/m0/s1 |
| InChIKey | NVVVBYLPMCOMTD-SFHVURJKSA-N |
| XLogP | 4.83 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|