C10H19N5O — CID 176531862
1,1-dimethyl-3-[(4R)-4-(2-methylpropyl)-5-oxo-1,4-dihydroimidazol-2-yl]guanidine (PubChem CID 176531862) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(4R)-4-(2-methylpropyl)-5-oxo-1,4-dihydroimidazol-2-yl]guanidine.
| Compound Name | 1,1-dimethyl-3-[(4R)-4-(2-methylpropyl)-5-oxo-1,4-dihydroimidazol-2-yl]guanidine |
|---|---|
| PubChem CID | 176531862 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1,1-dimethyl-3-[(4R)-4-(2-methylpropyl)-5-oxo-1,4-dihydroimidazol-2-yl]guanidine |
| SMILES | [H]/N=C(/NC1=N[C@H](CC(C)C)C(=O)N1)N(C)C |
| InChI | InChI=1S/C10H19N5O/c1-6(2)5-7-8(16)13-10(12-7)14-9(11)15(3)4/h6-7H,5H2,1-4H3,(H3,11,12,13,14,16)/t7-/m1/s1 |
| InChIKey | KTMRCCBUJZFBKS-SSDOTTSWSA-N |
| XLogP | -0.03 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|