C6H10FN3O2 — CID 176532385
2-fluoro-6-(1-methoxyethoxy)-1,2-dihydro-1,3,5-triazine (PubChem CID 176532385) has the molecular formula C6H10FN3O2 and a molecular weight of 175.16 g/mol. Its IUPAC name is 2-fluoro-6-(1-methoxyethoxy)-1,2-dihydro-1,3,5-triazine.
| Compound Name | 2-fluoro-6-(1-methoxyethoxy)-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 176532385 |
| Molecular Formula | C6H10FN3O2 |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-fluoro-6-(1-methoxyethoxy)-1,2-dihydro-1,3,5-triazine |
| SMILES | COC(C)OC1=NC=NC(F)N1 |
| InChI | InChI=1S/C6H10FN3O2/c1-4(11-2)12-6-9-3-8-5(7)10-6/h3-5H,1-2H3,(H,8,9,10) |
| InChIKey | DVKCNWBXNMQPEJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|