C12H18N2 — CID 176532679
N'-[(1Z)-penta-1,3,4-trienyl]-N-prop-1-en-2-ylbutanimidamide (PubChem CID 176532679) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N'-[(1Z)-penta-1,3,4-trienyl]-N-prop-1-en-2-ylbutanimidamide.
| Compound Name | N'-[(1Z)-penta-1,3,4-trienyl]-N-prop-1-en-2-ylbutanimidamide |
|---|---|
| PubChem CID | 176532679 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N'-[(1Z)-penta-1,3,4-trienyl]-N-prop-1-en-2-ylbutanimidamide |
| SMILES | C=C=C/C=C\N=C(/CCC)NC(=C)C |
| InChI | InChI=1S/C12H18N2/c1-5-7-8-10-13-12(9-6-2)14-11(3)4/h7-8,10H,1,3,6,9H2,2,4H3,(H,13,14)/b10-8- |
| InChIKey | DNZBRWRIXPVKFX-NTMALXAHSA-N |
| XLogP | 3.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|