C28H47IN4 — CID 176532732
N'-[(Z,4Z)-4-ethylidenehept-2-en-3-yl]-N-[5-[1-[[(3E,5Z)-2-iodo-4-propylhepta-1,3,5-trien-3-yl]amino]ethylideneamino]pentyl]ethanimidamide (PubChem CID 176532732) has the molecular formula C28H47IN4 and a molecular weight of 566.62 g/mol. Its IUPAC name is N'-[(Z,4Z)-4-ethylidenehept-2-en-3-yl]-N-[5-[1-[[(3E,5Z)-2-iodo-4-propylhepta-1,3,5-trien-3-yl]amino]ethylideneamino]pentyl]ethanimidamide.
| Compound Name | N'-[(Z,4Z)-4-ethylidenehept-2-en-3-yl]-N-[5-[1-[[(3E,5Z)-2-iodo-4-propylhepta-1,3,5-trien-3-yl]amino]ethylideneamino]pentyl]ethanimidamide |
|---|---|
| PubChem CID | 176532732 |
| Molecular Formula | C28H47IN4 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | N'-[(Z,4Z)-4-ethylidenehept-2-en-3-yl]-N-[5-[1-[[(3E,5Z)-2-iodo-4-propylhepta-1,3,5-trien-3-yl]amino]ethylideneamino]pentyl]ethanimidamide |
| SMILES | C=C(I)/C(N/C(C)=N/CCCCCN/C(C)=N/C(=C\C)/C(=C\C)CCC)=C(\C=C/C)CCC |
| InChI | InChI=1S/C28H47IN4/c1-9-17-25(12-4)27(13-5)32-23(7)30-20-15-14-16-21-31-24(8)33-28(22(6)29)26(18-10-2)19-11-3/h10,12-13,18H,6,9,11,14-17,19-21H2,1-5,7-8H3,(H,30,32)(H,31,33)/b18-10-,25-12-,27-13-,28-26- |
| InChIKey | KEGSAWUCUQRVMM-PKHDJNRNSA-N |
| XLogP | 8.40 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|