About 4-N-methyl-9H-purine-1,4-diamine
4-N-methyl-9H-purine-1,4-diamine (PubChem CID 176532740) has the molecular formula C6H10N6
and a molecular weight of 166.19 g/mol. Its IUPAC name is 4-N-methyl-9H-purine-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-methyl-9H-purine-1,4-diamine |
| PubChem CID | 176532740 |
| Molecular Formula | C6H10N6 |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 4-N-methyl-9H-purine-1,4-diamine |
| SMILES | CNC12N=CN(N)C=C1N=CN2 |
| InChI | InChI=1S/C6H10N6/c1-8-6-5(9-3-10-6)2-12(7)4-11-6/h2-4,8H,7H2,1H3,(H,9,10) |
| InChIKey | MYFJSFIOJBWLHA-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4-N-methyl-9H-purine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methyl-9H-purine-1,4-diamine?
The IUPAC name of 4-N-methyl-9H-purine-1,4-diamine (CID 176532740) is 4-N-methyl-9H-purine-1,4-diamine.
What is the SMILES notation for 4-N-methyl-9H-purine-1,4-diamine?
The canonical SMILES for 4-N-methyl-9H-purine-1,4-diamine is CNC12N=CN(N)C=C1N=CN2.
What is the InChIKey of 4-N-methyl-9H-purine-1,4-diamine?
The InChIKey is MYFJSFIOJBWLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N6/c1-8-6-5(9-3-10-6)2-12(7)4-11-6/h2-4,8H,7H2,1H3,(H,9,10).
What are the key properties of 4-N-methyl-9H-purine-1,4-diamine?
4-N-methyl-9H-purine-1,4-diamine has a molecular weight of 166.19 g/mol, XLogP of -1.45, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methyl-9H-purine-1,4-diamine is sourced from PubChem (CID 176532740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).