C10H13F3N4 — CID 176533036
4-[(E)-5,5-difluoro-1,4-diiminohex-2-en-2-yl]imino-3-fluorobut-2-en-2-amine (PubChem CID 176533036) has the molecular formula C10H13F3N4 and a molecular weight of 246.24 g/mol. Its IUPAC name is 4-[(E)-5,5-difluoro-1,4-diiminohex-2-en-2-yl]imino-3-fluorobut-2-en-2-amine.
| Compound Name | 4-[(E)-5,5-difluoro-1,4-diiminohex-2-en-2-yl]imino-3-fluorobut-2-en-2-amine |
|---|---|
| PubChem CID | 176533036 |
| Molecular Formula | C10H13F3N4 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-[(E)-5,5-difluoro-1,4-diiminohex-2-en-2-yl]imino-3-fluorobut-2-en-2-amine |
| SMILES | [H]/N=C(/C=C(\C=N\[H])/N=C/C(F)=C(C)N)C(C)(F)F |
| InChI | InChI=1S/C10H13F3N4/c1-6(15)8(11)5-17-7(4-14)3-9(16)10(2,12)13/h3-5,14,16H,15H2,1-2H3/b7-3+,8-6?,14-4+,16-9-,17-5+ |
| InChIKey | IWJINBWCDBWRQF-FWXSAPRMSA-N |
| XLogP | 2.43 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|