C11H15F3N4 — CID 176533037
1-[(E)-5,5-difluoro-1,4-diiminohex-2-en-2-yl]imino-2-fluoropent-2-en-3-amine (PubChem CID 176533037) has the molecular formula C11H15F3N4 and a molecular weight of 260.26 g/mol. Its IUPAC name is 1-[(E)-5,5-difluoro-1,4-diiminohex-2-en-2-yl]imino-2-fluoropent-2-en-3-amine.
| Compound Name | 1-[(E)-5,5-difluoro-1,4-diiminohex-2-en-2-yl]imino-2-fluoropent-2-en-3-amine |
|---|---|
| PubChem CID | 176533037 |
| Molecular Formula | C11H15F3N4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-[(E)-5,5-difluoro-1,4-diiminohex-2-en-2-yl]imino-2-fluoropent-2-en-3-amine |
| SMILES | [H]/N=C(/C=C(\C=N\[H])/N=C/C(F)=C(N)CC)C(C)(F)F |
| InChI | InChI=1S/C11H15F3N4/c1-3-9(16)8(12)6-18-7(5-15)4-10(17)11(2,13)14/h4-6,15,17H,3,16H2,1-2H3/b7-4+,9-8?,15-5+,17-10-,18-6+ |
| InChIKey | NNICMGMOIAYTAL-JIEKWARFSA-N |
| XLogP | 2.82 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|