C13H18F3N3 — CID 176533038
(E)-N-[(Z)-3-iminobut-1-enyl]-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminobut-2-en-2-amine (PubChem CID 176533038) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is (E)-N-[(Z)-3-iminobut-1-enyl]-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminobut-2-en-2-amine.
| Compound Name | (E)-N-[(Z)-3-iminobut-1-enyl]-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminobut-2-en-2-amine |
|---|---|
| PubChem CID | 176533038 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (E)-N-[(Z)-3-iminobut-1-enyl]-1-[(Z)-1,1,1-trifluoropent-2-en-2-yl]iminobut-2-en-2-amine |
| SMILES | [H]/N=C(C)/C=C\NC(/C=N/C(=C\CC)C(F)(F)F)=C/C |
| InChI | InChI=1S/C13H18F3N3/c1-4-6-12(13(14,15)16)19-9-11(5-2)18-8-7-10(3)17/h5-9,17-18H,4H2,1-3H3/b8-7-,11-5+,12-6-,17-10+,19-9+ |
| InChIKey | OQQWVDZLFMEFMC-GRSNYHNISA-N |
| XLogP | 3.96 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|