C17H34N10 — CID 176533085
1-[2-[(4S,6R)-4-[2-[(N'-carbamimidoylcarbamimidoyl)-methylamino]ethyl]-6-methylcyclohex-2-en-1-yl]ethyl]-3-(diaminomethylidene)-1-methylguanidine (PubChem CID 176533085) has the molecular formula C17H34N10 and a molecular weight of 378.53 g/mol. Its IUPAC name is 1-[2-[(4S,6R)-4-[2-[(N'-carbamimidoylcarbamimidoyl)-methylamino]ethyl]-6-methylcyclohex-2-en-1-yl]ethyl]-3-(diaminomethylidene)-1-methylguanidine.
| Compound Name | 1-[2-[(4S,6R)-4-[2-[(N'-carbamimidoylcarbamimidoyl)-methylamino]ethyl]-6-methylcyclohex-2-en-1-yl]ethyl]-3-(diaminomethylidene)-1-methylguanidine |
|---|---|
| PubChem CID | 176533085 |
| Molecular Formula | C17H34N10 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 1-[2-[(4S,6R)-4-[2-[(N'-carbamimidoylcarbamimidoyl)-methylamino]ethyl]-6-methylcyclohex-2-en-1-yl]ethyl]-3-(diaminomethylidene)-1-methylguanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(C)CCC1C=C[C@H](CCN(C)C(N)=N/C(N)=N/[H])C[C@H]1C |
| InChI | InChI=1S/C17H34N10/c1-11-10-12(6-8-26(2)16(22)24-14(18)19)4-5-13(11)7-9-27(3)17(23)25-15(20)21/h4-5,11-13H,6-10H2,1-3H3,(H5,18,19,22,24)(H5,20,21,23,25)/t11-,12-,13?/m1/s1 |
| InChIKey | WZVGJSOZHFGUSI-ZNRZSNADSA-N |
| XLogP | -0.13 |
| TPSA | 182.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|