C18H38N10 — CID 176533086
1-[(Z,3S)-8-[(N'-carbamimidoylcarbamimidoyl)-methylamino]-3-(2-methylpropyl)oct-4-enyl]-3-(diaminomethylidene)-1-methylguanidine (PubChem CID 176533086) has the molecular formula C18H38N10 and a molecular weight of 394.57 g/mol. Its IUPAC name is 1-[(Z,3S)-8-[(N'-carbamimidoylcarbamimidoyl)-methylamino]-3-(2-methylpropyl)oct-4-enyl]-3-(diaminomethylidene)-1-methylguanidine.
| Compound Name | 1-[(Z,3S)-8-[(N'-carbamimidoylcarbamimidoyl)-methylamino]-3-(2-methylpropyl)oct-4-enyl]-3-(diaminomethylidene)-1-methylguanidine |
|---|---|
| PubChem CID | 176533086 |
| Molecular Formula | C18H38N10 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | 1-[(Z,3S)-8-[(N'-carbamimidoylcarbamimidoyl)-methylamino]-3-(2-methylpropyl)oct-4-enyl]-3-(diaminomethylidene)-1-methylguanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(C)CCC(/C=C\CCCN(C)C(N)=N/C(N)=N/[H])CC(C)C |
| InChI | InChI=1S/C18H38N10/c1-13(2)12-14(9-11-28(4)18(24)26-16(21)22)8-6-5-7-10-27(3)17(23)25-15(19)20/h6,8,13-14H,5,7,9-12H2,1-4H3,(H5,19,20,23,25)(H5,21,22,24,26)/b8-6- |
| InChIKey | SPLMDDKXOSBVFV-VURMDHGXSA-N |
| XLogP | 0.66 |
| TPSA | 182.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|