C17H30N4 — CID 176533146
N'-[N-ethyl-N'-[(1S)-4-ethyl-1-methylcyclohexa-2,4-dien-1-yl]carbamimidoyl]-N,N-dimethylpropanimidamide (PubChem CID 176533146) has the molecular formula C17H30N4 and a molecular weight of 290.45 g/mol. Its IUPAC name is N'-[N-ethyl-N'-[(1S)-4-ethyl-1-methylcyclohexa-2,4-dien-1-yl]carbamimidoyl]-N,N-dimethylpropanimidamide.
| Compound Name | N'-[N-ethyl-N'-[(1S)-4-ethyl-1-methylcyclohexa-2,4-dien-1-yl]carbamimidoyl]-N,N-dimethylpropanimidamide |
|---|---|
| PubChem CID | 176533146 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | N'-[N-ethyl-N'-[(1S)-4-ethyl-1-methylcyclohexa-2,4-dien-1-yl]carbamimidoyl]-N,N-dimethylpropanimidamide |
| SMILES | CCN/C(N=C(CC)N(C)C)=N\[C@]1(C)C=CC(CC)=CC1 |
| InChI | InChI=1S/C17H30N4/c1-7-14-10-12-17(4,13-11-14)20-16(18-9-3)19-15(8-2)21(5)6/h10-12H,7-9,13H2,1-6H3,(H,18,20)/t17-/m1/s1 |
| InChIKey | MFWOYYQIRIYWRA-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|