C12H19N5 — CID 176533287
4-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6,6-dimethyl-1H-1,3,5-triazine-2,4-diamine (PubChem CID 176533287) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 4-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6,6-dimethyl-1H-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6,6-dimethyl-1H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 176533287 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6,6-dimethyl-1H-1,3,5-triazine-2,4-diamine |
| SMILES | C=C/C=C\C(=C/C)NC1=NC(C)(C)NC(N)=N1 |
| InChI | InChI=1S/C12H19N5/c1-5-7-8-9(6-2)14-11-15-10(13)16-12(3,4)17-11/h5-8H,1H2,2-4H3,(H4,13,14,15,16,17)/b8-7-,9-6+ |
| InChIKey | LSLPUGGCWYBZHY-SOKJVCRVSA-N |
| XLogP | 1.23 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|