About butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride
butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride (PubChem CID 176533535) has the molecular formula C10H26ClN5O
and a molecular weight of 267.80 g/mol. Its IUPAC name is butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride.
Molecular Properties
| Compound Name | butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride |
| PubChem CID | 176533535 |
| Molecular Formula | C10H26ClN5O |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride |
| SMILES | CCCCO.Cl.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C6H15N5.C4H10O.ClH/c1-2-3-4-10-6(9)11-5(7)8;1-2-3-4-5;/h2-4H2,1H3,(H6,7,8,9,10,11);5H,2-4H2,1H3;1H |
| InChIKey | FRBWGQVCTXKNJS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride?
The IUPAC name of butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride (CID 176533535) is butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride.
What is the SMILES notation for butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride?
The canonical SMILES for butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride is CCCCO.Cl.[H]/N=C(\N)N/C(N)=N/CCCC.
What is the InChIKey of butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride?
The InChIKey is FRBWGQVCTXKNJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N5.C4H10O.ClH/c1-2-3-4-10-6(9)11-5(7)8;1-2-3-4-5;/h2-4H2,1H3,(H6,7,8,9,10,11);5H,2-4H2,1H3;1H.
What are the key properties of butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride?
butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride has a molecular weight of 267.80 g/mol, XLogP of 0.78, 5 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;2-butyl-1-carbamimidoylguanidine;hydrochloride is sourced from PubChem (CID 176533535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).