C4H11N5 — CID 176533590
2-amino-N-(diaminomethylidene)propanimidamide (PubChem CID 176533590) has the molecular formula C4H11N5 and a molecular weight of 129.17 g/mol. Its IUPAC name is 2-amino-N-(diaminomethylidene)propanimidamide.
| Compound Name | 2-amino-N-(diaminomethylidene)propanimidamide |
|---|---|
| PubChem CID | 176533590 |
| Molecular Formula | C4H11N5 |
| Molecular Weight | 129.17 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 2-amino-N-(diaminomethylidene)propanimidamide |
| SMILES | [H]/N=C(\N=C(N)N)C(C)N |
| InChI | InChI=1S/C4H11N5/c1-2(5)3(6)9-4(7)8/h2H,5H2,1H3,(H5,6,7,8,9) |
| InChIKey | KVXVTFPZFKOESB-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.17 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|