C10H21N5 — CID 176533742
6-N-butyl-4-N,4-N,2-trimethyl-1,2-dihydro-1,3,5-triazine-4,6-diamine (PubChem CID 176533742) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is 6-N-butyl-4-N,4-N,2-trimethyl-1,2-dihydro-1,3,5-triazine-4,6-diamine.
| Compound Name | 6-N-butyl-4-N,4-N,2-trimethyl-1,2-dihydro-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 176533742 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 6-N-butyl-4-N,4-N,2-trimethyl-1,2-dihydro-1,3,5-triazine-4,6-diamine |
| SMILES | CCCCNC1=NC(N(C)C)=NC(C)N1 |
| InChI | InChI=1S/C10H21N5/c1-5-6-7-11-9-12-8(2)13-10(14-9)15(3)4/h8H,5-7H2,1-4H3,(H2,11,12,13,14) |
| InChIKey | DFUYDTJUCQQPFL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|