C15H32N10O6 — CID 176533797
1-[[(2R,3S,4R,5R,6R)-6-[(1R,2R,3S,4R,6S)-4-amino-6-(diaminomethylideneamino)-2,3-dihydroxycyclohexyl]oxy-5-(diaminomethylideneamino)-3,4-dihydroxyoxan-2-yl]methyl]guanidine (PubChem CID 176533797) has the molecular formula C15H32N10O6 and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-[[(2R,3S,4R,5R,6R)-6-[(1R,2R,3S,4R,6S)-4-amino-6-(diaminomethylideneamino)-2,3-dihydroxycyclohexyl]oxy-5-(diaminomethylideneamino)-3,4-dihydroxyoxan-2-yl]methyl]guanidine.
| Compound Name | 1-[[(2R,3S,4R,5R,6R)-6-[(1R,2R,3S,4R,6S)-4-amino-6-(diaminomethylideneamino)-2,3-dihydroxycyclohexyl]oxy-5-(diaminomethylideneamino)-3,4-dihydroxyoxan-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 176533797 |
| Molecular Formula | C15H32N10O6 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-[[(2R,3S,4R,5R,6R)-6-[(1R,2R,3S,4R,6S)-4-amino-6-(diaminomethylideneamino)-2,3-dihydroxycyclohexyl]oxy-5-(diaminomethylideneamino)-3,4-dihydroxyoxan-2-yl]methyl]guanidine |
| SMILES | [H]/N=C(\N)NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N=C(N)N)[C@H](N=C(N)N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H32N10O6/c16-3-1-4(24-14(19)20)11(10(29)7(3)26)31-12-6(25-15(21)22)9(28)8(27)5(30-12)2-23-13(17)18/h3-12,26-29H,1-2,16H2,(H4,17,18,23)(H4,19,20,24)(H4,21,22,25)/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | AXXFTNPLLFKBSI-HKEUSBCWSA-N |
| XLogP | -6.96 |
| TPSA | 316.10 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | -6.96 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|