About 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine
1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine (PubChem CID 176534110) has the molecular formula C8H20N10
and a molecular weight of 256.32 g/mol. Its IUPAC name is 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine.
Molecular Properties
| Compound Name | 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine |
| PubChem CID | 176534110 |
| Molecular Formula | C8H20N10 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine |
| SMILES | [H]/N=C(\N)N=C(N)NN(CCCC)/C(N=C(N)N)=N/[H] |
| InChI | InChI=1S/C8H20N10/c1-2-3-4-18(8(14)16-6(11)12)17-7(13)15-5(9)10/h2-4H2,1H3,(H5,11,12,14,16)(H6,9,10,13,15,17) |
| InChIKey | YRZSRRJCLVPYKU-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 191.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine?
The IUPAC name of 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine (CID 176534110) is 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine.
What is the SMILES notation for 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine?
The canonical SMILES for 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine is [H]/N=C(\N)N=C(N)NN(CCCC)/C(N=C(N)N)=N/[H].
What is the InChIKey of 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine?
The InChIKey is YRZSRRJCLVPYKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N10/c1-2-3-4-18(8(14)16-6(11)12)17-7(13)15-5(9)10/h2-4H2,1H3,(H5,11,12,14,16)(H6,9,10,13,15,17).
What are the key properties of 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine?
1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine has a molecular weight of 256.32 g/mol, XLogP of -1.99, 3 rotatable bonds, 7 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-[(N'-carbamimidoylcarbamimidoyl)amino]-3-(diaminomethylidene)guanidine is sourced from PubChem (CID 176534110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).