About 2-propa-1,2-dienylpyridin-3-amine
2-propa-1,2-dienylpyridin-3-amine (PubChem CID 176534340) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 2-propa-1,2-dienylpyridin-3-amine.
Molecular Properties
| Compound Name | 2-propa-1,2-dienylpyridin-3-amine |
| PubChem CID | 176534340 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2-propa-1,2-dienylpyridin-3-amine |
| SMILES | C=C=Cc1ncccc1N |
| InChI | InChI=1S/C8H8N2/c1-2-4-8-7(9)5-3-6-10-8/h3-6H,1,9H2 |
| InChIKey | RCIFPEKQKHZLIE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propa-1,2-dienylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propa-1,2-dienylpyridin-3-amine?
The IUPAC name of 2-propa-1,2-dienylpyridin-3-amine (CID 176534340) is 2-propa-1,2-dienylpyridin-3-amine.
What is the SMILES notation for 2-propa-1,2-dienylpyridin-3-amine?
The canonical SMILES for 2-propa-1,2-dienylpyridin-3-amine is C=C=Cc1ncccc1N.
What is the InChIKey of 2-propa-1,2-dienylpyridin-3-amine?
The InChIKey is RCIFPEKQKHZLIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-2-4-8-7(9)5-3-6-10-8/h3-6H,1,9H2.
What are the key properties of 2-propa-1,2-dienylpyridin-3-amine?
2-propa-1,2-dienylpyridin-3-amine has a molecular weight of 132.17 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propa-1,2-dienylpyridin-3-amine is sourced from PubChem (CID 176534340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).